C11H19N5O3 — CID 106234455
2-[2-[(5-amino-6-propoxypyrimidin-4-yl)amino]ethoxy]acetamide (PubChem CID 106234455) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[2-[(5-amino-6-propoxypyrimidin-4-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(5-amino-6-propoxypyrimidin-4-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106234455 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[2-[(5-amino-6-propoxypyrimidin-4-yl)amino]ethoxy]acetamide |
| SMILES | CCCOc1ncnc(NCCOCC(N)=O)c1N |
| InChI | InChI=1S/C11H19N5O3/c1-2-4-19-11-9(13)10(15-7-16-11)14-3-5-18-6-8(12)17/h7H,2-6,13H2,1H3,(H2,12,17)(H,14,15,16) |
| InChIKey | KYWZMHXRXBBAOS-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|