C13H24N4O2S — CID 115992256
2-amino-3-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]benzenesulfonamide (PubChem CID 115992256) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-amino-3-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]benzenesulfonamide.
| Compound Name | 2-amino-3-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 115992256 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-amino-3-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]benzenesulfonamide |
| SMILES | CN(C)CC(C)(C)CNc1cccc(S(N)(=O)=O)c1N |
| InChI | InChI=1S/C13H24N4O2S/c1-13(2,9-17(3)4)8-16-10-6-5-7-11(12(10)14)20(15,18)19/h5-7,16H,8-9,14H2,1-4H3,(H2,15,18,19) |
| InChIKey | PIJGOMFMMOXHFW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|