C14H19NO2S2 — CID 113488278
2-methylsulfanyl-6-(thian-4-ylmethylamino)benzoic acid (PubChem CID 113488278) has the molecular formula C14H19NO2S2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-methylsulfanyl-6-(thian-4-ylmethylamino)benzoic acid.
| Compound Name | 2-methylsulfanyl-6-(thian-4-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 113488278 |
| Molecular Formula | C14H19NO2S2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-methylsulfanyl-6-(thian-4-ylmethylamino)benzoic acid |
| SMILES | CSc1cccc(NCC2CCSCC2)c1C(=O)O |
| InChI | InChI=1S/C14H19NO2S2/c1-18-12-4-2-3-11(13(12)14(16)17)15-9-10-5-7-19-8-6-10/h2-4,10,15H,5-9H2,1H3,(H,16,17) |
| InChIKey | FPYDCWJFUKUYCY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |