C13H16N2S2 — CID 113385606
2-methylsulfanyl-6-(thiolan-2-ylmethylamino)benzonitrile (PubChem CID 113385606) has the molecular formula C13H16N2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is 2-methylsulfanyl-6-(thiolan-2-ylmethylamino)benzonitrile.
| Compound Name | 2-methylsulfanyl-6-(thiolan-2-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 113385606 |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-methylsulfanyl-6-(thiolan-2-ylmethylamino)benzonitrile |
| SMILES | CSc1cccc(NCC2CCCS2)c1C#N |
| InChI | InChI=1S/C13H16N2S2/c1-16-13-6-2-5-12(11(13)8-14)15-9-10-4-3-7-17-10/h2,5-6,10,15H,3-4,7,9H2,1H3 |
| InChIKey | BNTAHFYPWTYJCG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |