C7H5ClF3N7 — CID 114156673
2-chloro-N-(2H-tetrazol-5-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114156673) has the molecular formula C7H5ClF3N7 and a molecular weight of 279.61 g/mol. Its IUPAC name is 2-chloro-N-(2H-tetrazol-5-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2H-tetrazol-5-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114156673 |
| Molecular Formula | C7H5ClF3N7 |
| Molecular Weight | 279.61 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-chloro-N-(2H-tetrazol-5-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(NCc2nn[nH]n2)nc(Cl)n1 |
| InChI | InChI=1S/C7H5ClF3N7/c8-6-13-3(7(9,10)11)1-4(14-6)12-2-5-15-17-18-16-5/h1H,2H2,(H,12,13,14)(H,15,16,17,18) |
| InChIKey | AAWQEDMTOZGDIL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.61 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |