C10H7ClF3N3O — CID 82460854
2-chloro-N-(furan-2-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 82460854) has the molecular formula C10H7ClF3N3O and a molecular weight of 277.63 g/mol. Its IUPAC name is 2-chloro-N-(furan-2-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(furan-2-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 82460854 |
| Molecular Formula | C10H7ClF3N3O |
| Molecular Weight | 277.63 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-chloro-N-(furan-2-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(NCc2ccco2)nc(Cl)n1 |
| InChI | InChI=1S/C10H7ClF3N3O/c11-9-16-7(10(12,13)14)4-8(17-9)15-5-6-2-1-3-18-6/h1-4H,5H2,(H,15,16,17) |
| InChIKey | UNEYBXJVHOLDLM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |