C30H29BF12O5P2 — CID 159344094
[3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis(tris(fluoromethyl)-phenacylphosphanium) (PubChem CID 159344094) has the molecular formula C30H29BF12O5P2 and a molecular weight of 770.29 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis(tris(fluoromethyl)-phenacylphosphanium).
| Compound Name | [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis(tris(fluoromethyl)-phenacylphosphanium) |
|---|---|
| PubChem CID | 159344094 |
| Molecular Formula | C30H29BF12O5P2 |
| Molecular Weight | 770.29 g/mol |
| Exact Mass | 770.14 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis(tris(fluoromethyl)-phenacylphosphanium) |
| SMILES | O=C(C[P+](CF)(CF)CF)c1ccccc1.O=C(C[P+](CF)(CF)CF)c1ccccc1.[O-]B([O-])Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C11H13F3OP.C8H3BF6O3/c2*12-7-16(8-13,9-14)6-11(15)10-4-2-1-3-5-10;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)18-9(16)17/h2*1-5H,6-9H2;1-3H/q2*+1;-2 |
| InChIKey | LGMPRKQUASKRDT-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.29 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|