C62H51BF6O7P2 — CID 157387289
[3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis([2-(2-methoxyphenyl)-2-oxoethyl]-triphenylphosphanium) (PubChem CID 157387289) has the molecular formula C62H51BF6O7P2 and a molecular weight of 1094.83 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis([2-(2-methoxyphenyl)-2-oxoethyl]-triphenylphosphanium).
| Compound Name | [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis([2-(2-methoxyphenyl)-2-oxoethyl]-triphenylphosphanium) |
|---|---|
| PubChem CID | 157387289 |
| Molecular Formula | C62H51BF6O7P2 |
| Molecular Weight | 1094.83 g/mol |
| Exact Mass | 1094.31 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis([2-(2-methoxyphenyl)-2-oxoethyl]-triphenylphosphanium) |
| SMILES | COc1ccccc1C(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.COc1ccccc1C(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-]B([O-])Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C27H24O2P.C8H3BF6O3/c2*1-29-27-20-12-11-19-25(27)26(28)21-30(22-13-5-2-6-14-22,23-15-7-3-8-16-23)24-17-9-4-10-18-24;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)18-9(16)17/h2*2-20H,21H2,1H3;1-3H/q2*+1;-2 |
| InChIKey | BLOUTYWBXLVPFM-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 107.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1094.83 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|