C60H47BF6O7P2 — CID 139734331
[3,5-bis(trifluoromethyl)phenyl] bis[[2-(4-hydroxyphenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate (PubChem CID 139734331) has the molecular formula C60H47BF6O7P2 and a molecular weight of 1066.78 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[[2-(4-hydroxyphenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-(4-hydroxyphenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734331 |
| Molecular Formula | C60H47BF6O7P2 |
| Molecular Weight | 1066.78 g/mol |
| Exact Mass | 1066.28 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-(4-hydroxyphenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate |
| SMILES | O=C(CP(OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(CC(=O)c1ccc(O)cc1)(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C60H47BF6O7P2/c62-59(63,64)46-39-47(60(65,66)67)41-50(40-46)72-61(73-75(51-19-7-1-8-20-51,52-21-9-2-10-22-52,53-23-11-3-12-24-53)42-57(70)44-31-35-48(68)36-32-44)74-76(54-25-13-4-14-26-54,55-27-15-5-16-28-55,56-29-17-6-18-30-56)43-58(71)45-33-37-49(69)38-34-45/h1-41,68-69H,42-43H2 |
| InChIKey | ONBYTJDOQPPPTM-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.78 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|