C16H19BF6O3 — CID 131700774
[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 131700774) has the molecular formula C16H19BF6O3 and a molecular weight of 384.13 g/mol. Its IUPAC name is [(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 131700774 |
| Molecular Formula | C16H19BF6O3 |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)/C=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19BF6O3/c1-13(2,24)14(3,4)26-17(25)6-5-10-7-11(15(18,19)20)9-12(8-10)16(21,22)23/h5-9,24-25H,1-4H3/b6-5+ |
| InChIKey | YEPZQSLZSPSMKZ-AATRIKPKSA-N |
| XLogP | 4.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|