C11H22BClO3 — CID 87189288
[(E)-5-chloropent-1-enyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 87189288) has the molecular formula C11H22BClO3 and a molecular weight of 248.56 g/mol. Its IUPAC name is [(E)-5-chloropent-1-enyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [(E)-5-chloropent-1-enyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 87189288 |
| Molecular Formula | C11H22BClO3 |
| Molecular Weight | 248.56 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [(E)-5-chloropent-1-enyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)/C=C/CCCCl |
| InChI | InChI=1S/C11H22BClO3/c1-10(2,14)11(3,4)16-12(15)8-6-5-7-9-13/h6,8,14-15H,5,7,9H2,1-4H3/b8-6+ |
| InChIKey | BNWZEKUBHDQGTD-SOFGYWHQSA-N |
| XLogP | 2.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|