C13H14F6Si — CID 15312137
[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-trimethylsilane (PubChem CID 15312137) has the molecular formula C13H14F6Si and a molecular weight of 312.33 g/mol. Its IUPAC name is [(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-trimethylsilane.
| Compound Name | [(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 15312137 |
| Molecular Formula | C13H14F6Si |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F6Si/c1-20(2,3)5-4-9-6-10(12(14,15)16)8-11(7-9)13(17,18)19/h4-8H,1-3H3/b5-4+ |
| InChIKey | KMTTZKGMTPTHJX-SNAWJCMRSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|