About Benzene, [(dimethylsilyl)methyl]-
Benzene, [(dimethylsilyl)methyl]- (PubChem CID 6328719) has the molecular formula C9H13Si
and a molecular weight of 149.29 g/mol.
Molecular Properties
| Compound Name | Benzene, [(dimethylsilyl)methyl]- |
|---|
| PubChem CID | 6328719 |
|---|
| Molecular Formula | C9H13Si |
|---|
| Molecular Weight | 149.29 g/mol |
|---|
| Exact Mass | 149.08 |
|---|
| IUPAC Name | — |
|---|
| SMILES | C[Si](C)Cc1ccccc1 |
|---|
| InChI | InChI=1S/C9H13Si/c1-10(2)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
|---|
| InChIKey | SKDKWDVYZOKBPL-UHFFFAOYSA-N |
|---|
| XLogP | 2.52 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 149.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Benzene, [(dimethylsilyl)methyl]- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzene, [(dimethylsilyl)methyl]-?
The IUPAC name of Benzene, [(dimethylsilyl)methyl]- (CID 6328719) is not available.
What is the SMILES notation for Benzene, [(dimethylsilyl)methyl]-?
The canonical SMILES for Benzene, [(dimethylsilyl)methyl]- is C[Si](C)Cc1ccccc1.
What is the InChIKey of Benzene, [(dimethylsilyl)methyl]-?
The InChIKey is SKDKWDVYZOKBPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Si/c1-10(2)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3.
What are the key properties of Benzene, [(dimethylsilyl)methyl]-?
Benzene, [(dimethylsilyl)methyl]- has a molecular weight of 149.29 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Benzene, [(dimethylsilyl)methyl]- is sourced from PubChem (CID 6328719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).