About 1-iodopropane;3-(trifluoromethoxy)benzenethiol
1-iodopropane;3-(trifluoromethoxy)benzenethiol (PubChem CID 158925066) has the molecular formula C10H12F3IOS
and a molecular weight of 364.17 g/mol. Its IUPAC name is 1-iodopropane;3-(trifluoromethoxy)benzenethiol.
Molecular Properties
| Compound Name | 1-iodopropane;3-(trifluoromethoxy)benzenethiol |
| PubChem CID | 158925066 |
| Molecular Formula | C10H12F3IOS |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 1-iodopropane;3-(trifluoromethoxy)benzenethiol |
| SMILES | CCCI.FC(F)(F)Oc1cccc(S)c1 |
| InChI | InChI=1S/C7H5F3OS.C3H7I/c8-7(9,10)11-5-2-1-3-6(12)4-5;1-2-3-4/h1-4,12H;2-3H2,1H3 |
| InChIKey | JIIHJMICSDMKER-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-iodopropane;3-(trifluoromethoxy)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodopropane;3-(trifluoromethoxy)benzenethiol?
The IUPAC name of 1-iodopropane;3-(trifluoromethoxy)benzenethiol (CID 158925066) is 1-iodopropane;3-(trifluoromethoxy)benzenethiol.
What is the SMILES notation for 1-iodopropane;3-(trifluoromethoxy)benzenethiol?
The canonical SMILES for 1-iodopropane;3-(trifluoromethoxy)benzenethiol is CCCI.FC(F)(F)Oc1cccc(S)c1.
What is the InChIKey of 1-iodopropane;3-(trifluoromethoxy)benzenethiol?
The InChIKey is JIIHJMICSDMKER-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3OS.C3H7I/c8-7(9,10)11-5-2-1-3-6(12)4-5;1-2-3-4/h1-4,12H;2-3H2,1H3.
What are the key properties of 1-iodopropane;3-(trifluoromethoxy)benzenethiol?
1-iodopropane;3-(trifluoromethoxy)benzenethiol has a molecular weight of 364.17 g/mol, XLogP of 4.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodopropane;3-(trifluoromethoxy)benzenethiol is sourced from PubChem (CID 158925066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).