About CID 167396186
CID 167396186 (PubChem CID 167396186) has the molecular formula C7H5BF3O4
and a molecular weight of 220.92 g/mol.
Molecular Properties
| Compound Name | CID 167396186 |
| PubChem CID | 167396186 |
| Molecular Formula | C7H5BF3O4 |
| Molecular Weight | 220.92 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | — |
| SMILES | O[B]Oc1cc(O)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C7H5BF3O4/c9-7(10,11)14-5-1-4(12)2-6(3-5)15-8-13/h1-3,12-13H |
| InChIKey | KXAQBAXCFRFFPN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.92 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167396186 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167396186?
The IUPAC name of CID 167396186 (CID 167396186) is not available.
What is the SMILES notation for CID 167396186?
The canonical SMILES for CID 167396186 is O[B]Oc1cc(O)cc(OC(F)(F)F)c1.
What is the InChIKey of CID 167396186?
The InChIKey is KXAQBAXCFRFFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BF3O4/c9-7(10,11)14-5-1-4(12)2-6(3-5)15-8-13/h1-3,12-13H.
What are the key properties of CID 167396186?
CID 167396186 has a molecular weight of 220.92 g/mol, XLogP of 1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167396186 is sourced from PubChem (CID 167396186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).