C14H9F3O4 — CID 53222015
4-[3-hydroxy-5-(trifluoromethoxy)phenyl]benzoic acid (PubChem CID 53222015) has the molecular formula C14H9F3O4 and a molecular weight of 298.22 g/mol. Its IUPAC name is 4-[3-hydroxy-5-(trifluoromethoxy)phenyl]benzoic acid.
| Compound Name | 4-[3-hydroxy-5-(trifluoromethoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 53222015 |
| Molecular Formula | C14H9F3O4 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 4-[3-hydroxy-5-(trifluoromethoxy)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(O)cc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C14H9F3O4/c15-14(16,17)21-12-6-10(5-11(18)7-12)8-1-3-9(4-2-8)13(19)20/h1-7,18H,(H,19,20) |
| InChIKey | JOWRKFAYHDZXSZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |