C11H10F3N3O — CID 174958066
5-[3-ethyl-5-(trifluoromethoxy)phenyl]-1H-1,2,4-triazole (PubChem CID 174958066) has the molecular formula C11H10F3N3O and a molecular weight of 257.22 g/mol. Its IUPAC name is 5-[3-ethyl-5-(trifluoromethoxy)phenyl]-1H-1,2,4-triazole.
| Compound Name | 5-[3-ethyl-5-(trifluoromethoxy)phenyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 174958066 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 5-[3-ethyl-5-(trifluoromethoxy)phenyl]-1H-1,2,4-triazole |
| SMILES | CCc1cc(OC(F)(F)F)cc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C11H10F3N3O/c1-2-7-3-8(10-15-6-16-17-10)5-9(4-7)18-11(12,13)14/h3-6H,2H2,1H3,(H,15,16,17) |
| InChIKey | BBABLRQDMGTVLM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |