C27H34BBrO4 — CID 134904360
(1S,2S,6R,8S)-4-[(1S,2S)-1-bromo-3-[(4-methoxyphenyl)methoxy]-2-phenylpropyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 134904360) has the molecular formula C27H34BBrO4 and a molecular weight of 513.28 g/mol. Its IUPAC name is (1S,2S,6R,8S)-4-[(1S,2S)-1-bromo-3-[(4-methoxyphenyl)methoxy]-2-phenylpropyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R,8S)-4-[(1S,2S)-1-bromo-3-[(4-methoxyphenyl)methoxy]-2-phenylpropyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 134904360 |
| Molecular Formula | C27H34BBrO4 |
| Molecular Weight | 513.28 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | (1S,2S,6R,8S)-4-[(1S,2S)-1-bromo-3-[(4-methoxyphenyl)methoxy]-2-phenylpropyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | COc1ccc(COC[C@H](c2ccccc2)[C@@H](Br)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc1 |
| InChI | InChI=1S/C27H34BBrO4/c1-26(2)20-14-23(26)27(3)24(15-20)32-28(33-27)25(29)22(19-8-6-5-7-9-19)17-31-16-18-10-12-21(30-4)13-11-18/h5-13,20,22-25H,14-17H2,1-4H3/t20-,22+,23-,24+,25+,27-/m0/s1 |
| InChIKey | NLPOSWPJZUMXBL-BSLLKSJESA-N |
| XLogP | 6.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.28 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|