C29H41BN2O5 — CID 158711246
[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methyl N-[(1R)-3-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]carbamate (PubChem CID 158711246) has the molecular formula C29H41BN2O5 and a molecular weight of 508.47 g/mol. Its IUPAC name is [(2R)-1-prop-2-enoylpyrrolidin-2-yl]methyl N-[(1R)-3-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]carbamate.
| Compound Name | [(2R)-1-prop-2-enoylpyrrolidin-2-yl]methyl N-[(1R)-3-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]carbamate |
|---|---|
| PubChem CID | 158711246 |
| Molecular Formula | C29H41BN2O5 |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | [(2R)-1-prop-2-enoylpyrrolidin-2-yl]methyl N-[(1R)-3-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]carbamate |
| SMILES | C=CC(=O)N1CCC[C@@H]1COC(=O)N[C@@H](CCc1ccc(C)cc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C29H41BN2O5/c1-6-26(33)32-15-7-8-22(32)18-35-27(34)31-25(14-13-20-11-9-19(2)10-12-20)30-36-24-17-21-16-23(28(21,3)4)29(24,5)37-30/h6,9-12,21-25H,1,7-8,13-18H2,2-5H3,(H,31,34)/t21-,22+,23-,24+,25-,29-/m0/s1 |
| InChIKey | IITBXYAKPYFAIY-NMSYFLLASA-N |
| XLogP | 4.47 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|