C32H48BN3O5 — CID 10188011
(2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[(1R)-3-(4-methylphenyl)-1-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxamide (PubChem CID 10188011) has the molecular formula C32H48BN3O5 and a molecular weight of 565.56 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[(1R)-3-(4-methylphenyl)-1-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[(1R)-3-(4-methylphenyl)-1-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10188011 |
| Molecular Formula | C32H48BN3O5 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[(1R)-3-(4-methylphenyl)-1-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCc1ccc(C)cc1)B1O[C@H]2C[C@@H]3C[C@@H](C3(C)C)[C@@]2(C)O1)C(C)C |
| InChI | InChI=1S/C32H48BN3O5/c1-19(2)28(34-21(4)37)30(39)36-16-8-9-24(36)29(38)35-27(15-14-22-12-10-20(3)11-13-22)33-40-26-18-23-17-25(31(23,5)6)32(26,7)41-33/h10-13,19,23-28H,8-9,14-18H2,1-7H3,(H,34,37)(H,35,38)/t23-,24-,25-,26-,27-,28-,32+/m0/s1 |
| InChIKey | LVGOADSCTBPHBX-LHPNAYOESA-N |
| XLogP | 3.83 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|