C25H27BClN3O5S — CID 174046943
N'-[2-(1-benzofuran-3-yl)-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-N-(5-chloro-1,3-thiazol-2-yl)oxamide (PubChem CID 174046943) has the molecular formula C25H27BClN3O5S and a molecular weight of 527.84 g/mol. Its IUPAC name is N'-[2-(1-benzofuran-3-yl)-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-N-(5-chloro-1,3-thiazol-2-yl)oxamide.
| Compound Name | N'-[2-(1-benzofuran-3-yl)-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-N-(5-chloro-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 174046943 |
| Molecular Formula | C25H27BClN3O5S |
| Molecular Weight | 527.84 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | N'-[2-(1-benzofuran-3-yl)-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-N-(5-chloro-1,3-thiazol-2-yl)oxamide |
| SMILES | CC1(C)C2CC1[C@]1(C)OB(C(Cc3coc4ccccc34)NC(=O)C(=O)Nc3ncc(Cl)s3)O[C@@H]1C2 |
| InChI | InChI=1S/C25H27BClN3O5S/c1-24(2)14-9-17(24)25(3)18(10-14)34-26(35-25)19(8-13-12-33-16-7-5-4-6-15(13)16)29-21(31)22(32)30-23-28-11-20(27)36-23/h4-7,11-12,14,17-19H,8-10H2,1-3H3,(H,29,31)(H,28,30,32)/t14?,17?,18-,19?,25+/m1/s1 |
| InChIKey | JFFTUVGKNMTBTK-ZIHCBDKMSA-N |
| XLogP | 4.48 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|