C24H35BF2N2O3 — CID 53362309
(2S)-2-amino-3-(3,5-difluorophenyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide (PubChem CID 53362309) has the molecular formula C24H35BF2N2O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,5-difluorophenyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide.
| Compound Name | (2S)-2-amino-3-(3,5-difluorophenyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
|---|---|
| PubChem CID | 53362309 |
| Molecular Formula | C24H35BF2N2O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (2S)-2-amino-3-(3,5-difluorophenyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1cc(F)cc(F)c1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C24H35BF2N2O3/c1-13(2)6-21(29-22(30)18(28)9-14-7-16(26)12-17(27)8-14)25-31-20-11-15-10-19(23(15,3)4)24(20,5)32-25/h7-8,12-13,15,18-21H,6,9-11,28H2,1-5H3,(H,29,30)/t15-,18-,19-,20+,21-,24-/m0/s1 |
| InChIKey | IOOOAGTZQRICTL-HPBBDLCZSA-N |
| XLogP | 3.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|