C23H34BNO4S — CID 177297201
(4R)-7-oxo-7-phenyl-4-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptane-2-sulfinamide (PubChem CID 177297201) has the molecular formula C23H34BNO4S and a molecular weight of 431.41 g/mol. Its IUPAC name is (4R)-7-oxo-7-phenyl-4-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptane-2-sulfinamide.
| Compound Name | (4R)-7-oxo-7-phenyl-4-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptane-2-sulfinamide |
|---|---|
| PubChem CID | 177297201 |
| Molecular Formula | C23H34BNO4S |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (4R)-7-oxo-7-phenyl-4-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptane-2-sulfinamide |
| SMILES | CC(C[C@@H](CCC(=O)c1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1)S(N)=O |
| InChI | InChI=1S/C23H34BNO4S/c1-15(30(25)27)12-18(10-11-19(26)16-8-6-5-7-9-16)24-28-21-14-17-13-20(22(17,2)3)23(21,4)29-24/h5-9,15,17-18,20-21H,10-14,25H2,1-4H3/t15?,17-,18+,20-,21+,23-,30?/m0/s1 |
| InChIKey | WGGPBKCHJYRXLU-LUUVUNROSA-N |
| XLogP | 4.15 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|