C25H38BN3O5 — CID 11641362
N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]pyridine-3-carboxamide (PubChem CID 11641362) has the molecular formula C25H38BN3O5 and a molecular weight of 471.41 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11641362 |
| Molecular Formula | C25H38BN3O5 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]pyridine-3-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cccnc1)[C@@H](C)O)B1O[C@@H]2C[C@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C25H38BN3O5/c1-14(2)10-20(26-33-19-12-17-11-18(24(17,4)5)25(19,6)34-26)28-23(32)21(15(3)30)29-22(31)16-8-7-9-27-13-16/h7-9,13-15,17-21,30H,10-12H2,1-6H3,(H,28,32)(H,29,31)/t15-,17-,18+,19-,20+,21+,25+/m1/s1 |
| InChIKey | XMKCOVPOCDDEAK-HBITXLTRSA-N |
| XLogP | 2.36 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|