C28H40BN3O5 — CID 59855884
N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]-1H-indole-2-carboxamide (PubChem CID 59855884) has the molecular formula C28H40BN3O5 and a molecular weight of 509.46 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 59855884 |
| Molecular Formula | C28H40BN3O5 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]-1H-indole-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cc2ccccc2[nH]1)[C@@H](C)O)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C28H40BN3O5/c1-15(2)11-23(29-36-22-14-18-13-21(27(18,4)5)28(22,6)37-29)31-26(35)24(16(3)33)32-25(34)20-12-17-9-7-8-10-19(17)30-20/h7-10,12,15-16,18,21-24,30,33H,11,13-14H2,1-6H3,(H,31,35)(H,32,34)/t16-,18-,21-,22-,23+,24+,28+/m1/s1 |
| InChIKey | MXNYIHYZESQLBG-AQKXDCHDSA-N |
| XLogP | 3.45 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|