C30H39BIN3O5 — CID 147439811
N-[(3R)-3-hydroxy-1-[[1-[(1R,2S,6R,8S)-9-iodo-2,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]amino]-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide (PubChem CID 147439811) has the molecular formula C30H39BIN3O5 and a molecular weight of 659.37 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-1-[[1-[(1R,2S,6R,8S)-9-iodo-2,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]amino]-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide.
| Compound Name | N-[(3R)-3-hydroxy-1-[[1-[(1R,2S,6R,8S)-9-iodo-2,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]amino]-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 147439811 |
| Molecular Formula | C30H39BIN3O5 |
| Molecular Weight | 659.37 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | N-[(3R)-3-hydroxy-1-[[1-[(1R,2S,6R,8S)-9-iodo-2,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]amino]-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)c1cccc(-c2ccccc2)n1)[C@@H](C)O)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)I)[C@]2(C)O1 |
| InChI | InChI=1S/C30H39BIN3O5/c1-17(2)14-25(31-39-24-16-20-15-23(29(20,4)32)30(24,5)40-31)34-28(38)26(18(3)36)35-27(37)22-13-9-12-21(33-22)19-10-7-6-8-11-19/h6-13,17-18,20,23-26,36H,14-16H2,1-5H3,(H,34,38)(H,35,37)/t18-,20+,23+,24-,25?,26?,29?,30+/m1/s1 |
| InChIKey | DVZVMYUBTHGINN-HMGPUQICSA-N |
| XLogP | 4.19 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|