C25H38BN3O6 — CID 71046441
N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 71046441) has the molecular formula C25H38BN3O6 and a molecular weight of 487.41 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 71046441 |
| Molecular Formula | C25H38BN3O6 |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cccc[n+]1[O-])[C@@H](C)O)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C25H38BN3O6/c1-14(2)11-20(26-34-19-13-16-12-18(24(16,4)5)25(19,6)35-26)27-23(32)21(15(3)30)28-22(31)17-9-7-8-10-29(17)33/h7-10,14-16,18-21,30H,11-13H2,1-6H3,(H,27,32)(H,28,31)/t15-,16+,18+,19-,20+,21+,25+/m1/s1 |
| InChIKey | ZDFKKQMEMUMXLC-HMWRFEHSSA-N |
| XLogP | 1.60 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|