C29H46BN3O5 — CID 70834800
6-butyl-N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]pyridine-2-carboxamide (PubChem CID 70834800) has the molecular formula C29H46BN3O5 and a molecular weight of 527.52 g/mol. Its IUPAC name is 6-butyl-N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]pyridine-2-carboxamide.
| Compound Name | 6-butyl-N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70834800 |
| Molecular Formula | C29H46BN3O5 |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | 6-butyl-N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]pyridine-2-carboxamide |
| SMILES | CCCCc1cccc(C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)[C@@H](C)O)n1 |
| InChI | InChI=1S/C29H46BN3O5/c1-8-9-11-20-12-10-13-21(31-20)26(35)33-25(18(4)34)27(36)32-24(14-17(2)3)30-37-23-16-19-15-22(28(19,5)6)29(23,7)38-30/h10,12-13,17-19,22-25,34H,8-9,11,14-16H2,1-7H3,(H,32,36)(H,33,35)/t18-,19+,22+,23-,24+,25+,29+/m1/s1 |
| InChIKey | VDTKXSDZZUXEBV-VWIFEASOSA-N |
| XLogP | 3.70 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|