C27H34BN3O8 — CID 140759237
N-[(2S,3R)-1-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-3-hydroxy-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide (PubChem CID 140759237) has the molecular formula C27H34BN3O8 and a molecular weight of 539.39 g/mol. Its IUPAC name is N-[(2S,3R)-1-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-3-hydroxy-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide.
| Compound Name | N-[(2S,3R)-1-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-3-hydroxy-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 140759237 |
| Molecular Formula | C27H34BN3O8 |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-[(2S,3R)-1-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-3-hydroxy-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)n1)[C@@H](C)O)B1OC(=O)[C@H](C)O[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C27H34BN3O8/c1-15(2)14-22(28-38-26(35)17(4)37-18(5)27(36)39-28)30-25(34)23(16(3)32)31-24(33)21-13-9-12-20(29-21)19-10-7-6-8-11-19/h6-13,15-18,22-23,32H,14H2,1-5H3,(H,30,34)(H,31,33)/t16-,17-,18+,22+,23+/m1/s1 |
| InChIKey | YHLZSCXFIKCAKQ-KIRBEMFZSA-N |
| XLogP | 1.68 |
| TPSA | 153.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|