C26H32BN3O7S — CID 154504681
N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(5R)-5-methyl-4,8-dioxo-1,3,6,2-dioxathiaborocan-2-yl]butyl]amino]-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide (PubChem CID 154504681) has the molecular formula C26H32BN3O7S and a molecular weight of 541.44 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(5R)-5-methyl-4,8-dioxo-1,3,6,2-dioxathiaborocan-2-yl]butyl]amino]-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(5R)-5-methyl-4,8-dioxo-1,3,6,2-dioxathiaborocan-2-yl]butyl]amino]-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 154504681 |
| Molecular Formula | C26H32BN3O7S |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(5R)-5-methyl-4,8-dioxo-1,3,6,2-dioxathiaborocan-2-yl]butyl]amino]-1-oxobutan-2-yl]-6-phenylpyridine-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)n1)[C@@H](C)O)B1OC(=O)CS[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C26H32BN3O7S/c1-15(2)13-21(27-36-22(32)14-38-17(4)26(35)37-27)29-25(34)23(16(3)31)30-24(33)20-12-8-11-19(28-20)18-9-6-5-7-10-18/h5-12,15-17,21,23,31H,13-14H2,1-4H3,(H,29,34)(H,30,33)/t16-,17-,21+,23+/m1/s1 |
| InChIKey | NXNWHXGMVIOZRV-RVLCIERPSA-N |
| XLogP | 2.01 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|