C29H38BN3O7 — CID 147859747
N-[(2R,3S,6R)-6-[(7S)-6,7-dimethyl-4,9-dioxo-1,3,6,2-dioxazaboronan-2-yl]-2-hydroxy-8-methyl-4-oxononan-3-yl]-6-phenylpyridine-2-carboxamide (PubChem CID 147859747) has the molecular formula C29H38BN3O7 and a molecular weight of 551.45 g/mol. Its IUPAC name is N-[(2R,3S,6R)-6-[(7S)-6,7-dimethyl-4,9-dioxo-1,3,6,2-dioxazaboronan-2-yl]-2-hydroxy-8-methyl-4-oxononan-3-yl]-6-phenylpyridine-2-carboxamide.
| Compound Name | N-[(2R,3S,6R)-6-[(7S)-6,7-dimethyl-4,9-dioxo-1,3,6,2-dioxazaboronan-2-yl]-2-hydroxy-8-methyl-4-oxononan-3-yl]-6-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 147859747 |
| Molecular Formula | C29H38BN3O7 |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | N-[(2R,3S,6R)-6-[(7S)-6,7-dimethyl-4,9-dioxo-1,3,6,2-dioxazaboronan-2-yl]-2-hydroxy-8-methyl-4-oxononan-3-yl]-6-phenylpyridine-2-carboxamide |
| SMILES | CC(C)C[C@H](CC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)n1)[C@@H](C)O)B1OC(=O)C[C@H](C)N(C)CC(=O)O1 |
| InChI | InChI=1S/C29H38BN3O7/c1-18(2)14-22(30-39-26(36)15-19(3)33(5)17-27(37)40-30)16-25(35)28(20(4)34)32-29(38)24-13-9-12-23(31-24)21-10-7-6-8-11-21/h6-13,18-20,22,28,34H,14-17H2,1-5H3,(H,32,38)/t19-,20+,22+,28-/m0/s1 |
| InChIKey | HWLHFYXGVVIYOZ-MWNMUAJNSA-N |
| XLogP | 2.90 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|