C23H37BN2O6 — CID 174106392
(3aS,4S,6aR)-1-ethyl-3a-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-4,5-dicarboxylic acid (PubChem CID 174106392) has the molecular formula C23H37BN2O6 and a molecular weight of 448.37 g/mol. Its IUPAC name is (3aS,4S,6aR)-1-ethyl-3a-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-4,5-dicarboxylic acid.
| Compound Name | (3aS,4S,6aR)-1-ethyl-3a-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 174106392 |
| Molecular Formula | C23H37BN2O6 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (3aS,4S,6aR)-1-ethyl-3a-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-4,5-dicarboxylic acid |
| SMILES | CCN1CC[C@@]2(CCCB3O[C@@H]4C[C@@H]5C[C@@H](C5(C)C)[C@]4(C)O3)[C@@H]1CN(C(=O)O)[C@@H]2C(=O)O |
| InChI | InChI=1S/C23H37BN2O6/c1-5-25-10-8-23(16(25)13-26(20(29)30)18(23)19(27)28)7-6-9-24-31-17-12-14-11-15(21(14,2)3)22(17,4)32-24/h14-18H,5-13H2,1-4H3,(H,27,28)(H,29,30)/t14-,15-,16-,17+,18+,22-,23-/m0/s1 |
| InChIKey | OKRZLGGBQPKGNF-AYFUHRPLSA-N |
| XLogP | 3.02 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|