C27H42BNO6 — CID 174137071
4-O-tert-butyl 5-O-methyl (5R,8S)-1-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-4-azatricyclo[3.3.0.02,8]octane-4,5-dicarboxylate (PubChem CID 174137071) has the molecular formula C27H42BNO6 and a molecular weight of 487.45 g/mol. Its IUPAC name is 4-O-tert-butyl 5-O-methyl (5R,8S)-1-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-4-azatricyclo[3.3.0.02,8]octane-4,5-dicarboxylate.
| Compound Name | 4-O-tert-butyl 5-O-methyl (5R,8S)-1-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-4-azatricyclo[3.3.0.02,8]octane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 174137071 |
| Molecular Formula | C27H42BNO6 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 4-O-tert-butyl 5-O-methyl (5R,8S)-1-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-4-azatricyclo[3.3.0.02,8]octane-4,5-dicarboxylate |
| SMILES | COC(=O)[C@]12CC[C@H]3C(CN1C(=O)OC(C)(C)C)C32CCCB1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C27H42BNO6/c1-23(2,3)33-22(31)29-15-18-17-9-11-27(29,21(30)32-7)26(17,18)10-8-12-28-34-20-14-16-13-19(24(16,4)5)25(20,6)35-28/h16-20H,8-15H2,1-7H3/t16-,17-,18?,19-,20+,25-,26?,27-/m0/s1 |
| InChIKey | SLYYWKCLNFQPMZ-AUZYRZGDSA-N |
| XLogP | 4.68 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|