C21H33BN2O6 — CID 174106402
(3aS,4S,6aR)-3a-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4,5-dicarboxylic acid (PubChem CID 174106402) has the molecular formula C21H33BN2O6 and a molecular weight of 420.32 g/mol. Its IUPAC name is (3aS,4S,6aR)-3a-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4,5-dicarboxylic acid.
| Compound Name | (3aS,4S,6aR)-3a-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 174106402 |
| Molecular Formula | C21H33BN2O6 |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (3aS,4S,6aR)-3a-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4,5-dicarboxylic acid |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB(CCC[C@]45CCN[C@H]4CN(C(=O)O)[C@@H]5C(=O)O)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C21H33BN2O6/c1-19(2)12-9-13(19)20(3)15(10-12)29-22(30-20)7-4-5-21-6-8-23-14(21)11-24(18(27)28)16(21)17(25)26/h12-16,23H,4-11H2,1-3H3,(H,25,26)(H,27,28)/t12-,13-,14-,15+,16+,20-,21-/m0/s1 |
| InChIKey | UPABBILCLXLQBG-KHTLSARHSA-N |
| XLogP | 2.29 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|