C25H40BN3O5 — CID 162781677
(3aR,6aR)-5-[(2S)-pyrrolidine-2-carbonyl]-3a-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-2,3,4,6-tetrahydro-1H-pyrrolo[2,3-c]pyrrole-6a-carboxylic acid (PubChem CID 162781677) has the molecular formula C25H40BN3O5 and a molecular weight of 473.42 g/mol. Its IUPAC name is (3aR,6aR)-5-[(2S)-pyrrolidine-2-carbonyl]-3a-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-2,3,4,6-tetrahydro-1H-pyrrolo[2,3-c]pyrrole-6a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[(2S)-pyrrolidine-2-carbonyl]-3a-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-2,3,4,6-tetrahydro-1H-pyrrolo[2,3-c]pyrrole-6a-carboxylic acid |
|---|---|
| PubChem CID | 162781677 |
| Molecular Formula | C25H40BN3O5 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | (3aR,6aR)-5-[(2S)-pyrrolidine-2-carbonyl]-3a-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-2,3,4,6-tetrahydro-1H-pyrrolo[2,3-c]pyrrole-6a-carboxylic acid |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(CCC[C@]45CCN[C@@]4(C(=O)O)CN(C(=O)[C@@H]4CCCN4)C5)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C25H40BN3O5/c1-22(2)16-12-18(22)23(3)19(13-16)33-26(34-23)9-5-7-24-8-11-28-25(24,21(31)32)15-29(14-24)20(30)17-6-4-10-27-17/h16-19,27-28H,4-15H2,1-3H3,(H,31,32)/t16-,17+,18-,19+,23-,24-,25-/m1/s1 |
| InChIKey | PTQORDGLTSOGRX-CEHQXSLBSA-N |
| XLogP | 1.89 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|