C19H27N5O5S — CID 175775350
benzyl (3S,4R)-3-azido-1-[(2-hydroxy-2-methylpropyl)sulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 175775350) has the molecular formula C19H27N5O5S and a molecular weight of 437.52 g/mol. Its IUPAC name is benzyl (3S,4R)-3-azido-1-[(2-hydroxy-2-methylpropyl)sulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | benzyl (3S,4R)-3-azido-1-[(2-hydroxy-2-methylpropyl)sulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 175775350 |
| Molecular Formula | C19H27N5O5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | benzyl (3S,4R)-3-azido-1-[(2-hydroxy-2-methylpropyl)sulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@@H]1CN(S(=O)(=O)NCC(C)(C)O)C[C@]1(N=[N+]=[N-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27N5O5S/c1-4-8-16-11-24(30(27,28)21-13-18(2,3)26)14-19(16,22-23-20)17(25)29-12-15-9-6-5-7-10-15/h4-7,9-10,16,21,26H,1,8,11-14H2,2-3H3/t16-,19-/m1/s1 |
| InChIKey | DBOTZOYKWZXBGF-VQIMIIECSA-N |
| XLogP | 1.89 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|