C26H38N6O6S — CID 164837590
[(1R)-1-phenylethyl] (3R,4S)-3-azido-1-[ethyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]sulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 164837590) has the molecular formula C26H38N6O6S and a molecular weight of 562.69 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] (3R,4S)-3-azido-1-[ethyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]sulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | [(1R)-1-phenylethyl] (3R,4S)-3-azido-1-[ethyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]sulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 164837590 |
| Molecular Formula | C26H38N6O6S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [(1R)-1-phenylethyl] (3R,4S)-3-azido-1-[ethyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]sulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@H]1CN(S(=O)(=O)N(CC)C2CN(C(=O)OC(C)(C)C)C2)C[C@@]1(N=[N+]=[N-])C(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H38N6O6S/c1-7-12-21-15-31(18-26(21,28-29-27)23(33)37-19(3)20-13-10-9-11-14-20)39(35,36)32(8-2)22-16-30(17-22)24(34)38-25(4,5)6/h7,9-11,13-14,19,21-22H,1,8,12,15-18H2,2-6H3/t19-,21+,26+/m1/s1 |
| InChIKey | LNZZWXMQOGIFDO-DYRZZGSRSA-N |
| XLogP | 4.03 |
| TPSA | 145.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|