C16H24N4O4 — CID 155761166
(3aR,4S,5S,6aR)-5-azido-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-enyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 155761166) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (3aR,4S,5S,6aR)-5-azido-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-enyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,4S,5S,6aR)-5-azido-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-enyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 155761166 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (3aR,4S,5S,6aR)-5-azido-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-enyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | C=CC[C@H]1[C@@H]2CN(C(=O)OC(C)(C)C)C[C@@H]2C[C@@]1(N=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C16H24N4O4/c1-5-6-12-11-9-20(14(23)24-15(2,3)4)8-10(11)7-16(12,13(21)22)18-19-17/h5,10-12H,1,6-9H2,2-4H3,(H,21,22)/t10-,11+,12-,16-/m0/s1 |
| InChIKey | KIWQBCCFWRVUPI-BUWBCJGYSA-N |
| XLogP | 3.20 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|