C17H23NO2 — CID 155056332
[(1R)-1-phenylethyl] (3S,4R)-3-methyl-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 155056332) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] (3S,4R)-3-methyl-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | [(1R)-1-phenylethyl] (3S,4R)-3-methyl-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 155056332 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [(1R)-1-phenylethyl] (3S,4R)-3-methyl-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@H]1CNC[C@@]1(C)C(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H23NO2/c1-4-8-15-11-18-12-17(15,3)16(19)20-13(2)14-9-6-5-7-10-14/h4-7,9-10,13,15,18H,1,8,11-12H2,2-3H3/t13-,15+,17-/m1/s1 |
| InChIKey | GYCZRRNCMHPKFP-UKPHBRMFSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|