C16H18N4O3 — CID 118216035
phenacyl (3R,4S)-3-azido-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 118216035) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is phenacyl (3R,4S)-3-azido-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | phenacyl (3R,4S)-3-azido-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 118216035 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | phenacyl (3R,4S)-3-azido-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@H]1CNC[C@@]1(N=[N+]=[N-])C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N4O3/c1-2-6-13-9-18-11-16(13,19-20-17)15(22)23-10-14(21)12-7-4-3-5-8-12/h2-5,7-8,13,18H,1,6,9-11H2/t13-,16-/m0/s1 |
| InChIKey | ZTFSPJZREUVHIO-BBRMVZONSA-N |
| XLogP | 2.26 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|