C24H29N5O5S — CID 155204849
benzyl (4S)-3-azido-1-(2-phenylmethoxyethylsulfamoyl)-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 155204849) has the molecular formula C24H29N5O5S and a molecular weight of 499.59 g/mol. Its IUPAC name is benzyl (4S)-3-azido-1-(2-phenylmethoxyethylsulfamoyl)-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | benzyl (4S)-3-azido-1-(2-phenylmethoxyethylsulfamoyl)-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 155204849 |
| Molecular Formula | C24H29N5O5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | benzyl (4S)-3-azido-1-(2-phenylmethoxyethylsulfamoyl)-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@H]1CN(S(=O)(=O)NCCOCc2ccccc2)CC1(N=[N+]=[N-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H29N5O5S/c1-2-9-22-16-29(35(31,32)26-14-15-33-17-20-10-5-3-6-11-20)19-24(22,27-28-25)23(30)34-18-21-12-7-4-8-13-21/h2-8,10-13,22,26H,1,9,14-19H2/t22-,24?/m0/s1 |
| InChIKey | GFQPHEAVUQUGIB-OWJIYDKWSA-N |
| XLogP | 3.34 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|