C26H26N2O6 — CID 155793117
1-O-benzyl 2-O-methyl (2R,3R)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 155793117) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2R,3R)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2R,3R)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793117 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2R,3R)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@@H]1CCN(C(=O)OCc2ccccc2)[C@]1(CN1C(=O)c2ccccc2C1=O)C(=O)OC |
| InChI | InChI=1S/C26H26N2O6/c1-3-9-19-14-15-28(25(32)34-16-18-10-5-4-6-11-18)26(19,24(31)33-2)17-27-22(29)20-12-7-8-13-21(20)23(27)30/h3-8,10-13,19H,1,9,14-17H2,2H3/t19-,26+/m1/s1 |
| InChIKey | CZTAJYDZQKIICO-BCHFMIIMSA-N |
| XLogP | 3.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|