C17H20N2O3 — CID 70248030
benzyl (3aS,6aR)-5-oxo-6a-prop-2-enyl-3,3a,4,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate (PubChem CID 70248030) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is benzyl (3aS,6aR)-5-oxo-6a-prop-2-enyl-3,3a,4,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate.
| Compound Name | benzyl (3aS,6aR)-5-oxo-6a-prop-2-enyl-3,3a,4,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 70248030 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | benzyl (3aS,6aR)-5-oxo-6a-prop-2-enyl-3,3a,4,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
| SMILES | C=CC[C@@]12CC(=O)N[C@H]1CCN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20N2O3/c1-2-9-17-11-15(20)18-14(17)8-10-19(17)16(21)22-12-13-6-4-3-5-7-13/h2-7,14H,1,8-12H2,(H,18,20)/t14-,17+/m0/s1 |
| InChIKey | MHTLCDHSXPJWCL-WMLDXEAASA-N |
| XLogP | 2.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|