C19H23NO5 — CID 118960435
1-O-benzyl 4-O-ethyl 3-oxo-4-prop-2-enylpiperidine-1,4-dicarboxylate (PubChem CID 118960435) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-O-benzyl 4-O-ethyl 3-oxo-4-prop-2-enylpiperidine-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-ethyl 3-oxo-4-prop-2-enylpiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 118960435 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-O-benzyl 4-O-ethyl 3-oxo-4-prop-2-enylpiperidine-1,4-dicarboxylate |
| SMILES | C=CCC1(C(=O)OCC)CCN(C(=O)OCc2ccccc2)CC1=O |
| InChI | InChI=1S/C19H23NO5/c1-3-10-19(17(22)24-4-2)11-12-20(13-16(19)21)18(23)25-14-15-8-6-5-7-9-15/h3,5-9H,1,4,10-14H2,2H3 |
| InChIKey | USGQBJSIABEMGY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|