C21H30N4 — CID 146277008
(3aR,4S,6aR)-5-azido-5-benzyl-4-(3,3-dimethyl-2-methylidenebutyl)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 146277008) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is (3aR,4S,6aR)-5-azido-5-benzyl-4-(3,3-dimethyl-2-methylidenebutyl)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,4S,6aR)-5-azido-5-benzyl-4-(3,3-dimethyl-2-methylidenebutyl)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 146277008 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (3aR,4S,6aR)-5-azido-5-benzyl-4-(3,3-dimethyl-2-methylidenebutyl)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | C=C(C[C@H]1[C@@H]2CNC[C@@H]2CC1(Cc1ccccc1)N=[N+]=[N-])C(C)(C)C |
| InChI | InChI=1S/C21H30N4/c1-15(20(2,3)4)10-19-18-14-23-13-17(18)12-21(19,24-25-22)11-16-8-6-5-7-9-16/h5-9,17-19,23H,1,10-14H2,2-4H3/t17-,18+,19-,21?/m0/s1 |
| InChIKey | YDTAUMNTQIJBFQ-GSTYJUAJSA-N |
| XLogP | 5.13 |
| TPSA | 60.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|