C15H21NO — CID 175658095
(2R,3aR,7aS)-2-benzyl-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-c]pyridine (PubChem CID 175658095) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (2R,3aR,7aS)-2-benzyl-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-c]pyridine.
| Compound Name | (2R,3aR,7aS)-2-benzyl-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 175658095 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (2R,3aR,7aS)-2-benzyl-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-c]pyridine |
| SMILES | C[C@]1(Cc2ccccc2)C[C@@H]2CNCC[C@@H]2O1 |
| InChI | InChI=1S/C15H21NO/c1-15(9-12-5-3-2-4-6-12)10-13-11-16-8-7-14(13)17-15/h2-6,13-14,16H,7-11H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | WLORGTXXCPENGP-ILXRZTDVSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |