C13H18N4O2 — CID 122224429
(3S,5R,6R)-6-azido-5-phenylmethoxyazepan-3-ol (PubChem CID 122224429) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3S,5R,6R)-6-azido-5-phenylmethoxyazepan-3-ol.
| Compound Name | (3S,5R,6R)-6-azido-5-phenylmethoxyazepan-3-ol |
|---|---|
| PubChem CID | 122224429 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (3S,5R,6R)-6-azido-5-phenylmethoxyazepan-3-ol |
| SMILES | [N-]=[N+]=N[C@@H]1CNC[C@@H](O)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H18N4O2/c14-17-16-12-8-15-7-11(18)6-13(12)19-9-10-4-2-1-3-5-10/h1-5,11-13,15,18H,6-9H2/t11-,12+,13+/m0/s1 |
| InChIKey | WCOSALBIDZOUEZ-YNEHKIRRSA-N |
| XLogP | 1.60 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|