About tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate
tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate (PubChem CID 123560868) has the molecular formula C24H31ClN2O2
and a molecular weight of 414.98 g/mol. Its IUPAC name is tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate |
| PubChem CID | 123560868 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@]1(Cc2ccccc2)CNC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H31ClN2O2/c1-23(2,3)29-22(28)27-14-13-24(15-18-7-5-4-6-8-18)17-26-16-21(24)19-9-11-20(25)12-10-19/h4-12,21,26H,13-17H2,1-3H3,(H,27,28)/t21-,24+/m1/s1 |
| InChIKey | WPBCUDCXSUWUNR-QPPBQGQZSA-N |
| XLogP | 5.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate (CID 123560868) is tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate is CC(C)(C)OC(=O)NCC[C@]1(Cc2ccccc2)CNC[C@@H]1c1ccc(Cl)cc1.
What is the InChIKey of tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate?
The InChIKey is WPBCUDCXSUWUNR-QPPBQGQZSA-N. The full InChI is InChI=1S/C24H31ClN2O2/c1-23(2,3)29-22(28)27-14-13-24(15-18-7-5-4-6-8-18)17-26-16-21(24)19-9-11-20(25)12-10-19/h4-12,21,26H,13-17H2,1-3H3,(H,27,28)/t21-,24+/m1/s1.
What are the key properties of tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate?
tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate has a molecular weight of 414.98 g/mol, XLogP of 5.17, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(3S,4R)-3-benzyl-4-(4-chlorophenyl)pyrrolidin-3-yl]ethyl]carbamate is sourced from PubChem (CID 123560868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).