C21H25ClN2O2 — CID 162414764
tert-butyl N-[[(1S,2R)-1-benzyl-2-(2-chloro-4-pyridinyl)cyclopropyl]methyl]carbamate (PubChem CID 162414764) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is tert-butyl N-[[(1S,2R)-1-benzyl-2-(2-chloro-4-pyridinyl)cyclopropyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,2R)-1-benzyl-2-(2-chloro-4-pyridinyl)cyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 162414764 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | tert-butyl N-[[(1S,2R)-1-benzyl-2-(2-chloro-4-pyridinyl)cyclopropyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@]1(Cc2ccccc2)C[C@@H]1c1ccnc(Cl)c1 |
| InChI | InChI=1S/C21H25ClN2O2/c1-20(2,3)26-19(25)24-14-21(12-15-7-5-4-6-8-15)13-17(21)16-9-10-23-18(22)11-16/h4-11,17H,12-14H2,1-3H3,(H,24,25)/t17-,21+/m1/s1 |
| InChIKey | KRZLMHXZISQSJL-UTKZUKDTSA-N |
| XLogP | 4.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|