C18H20ClN3O3 — CID 86673154
tert-butyl N-[[3-[(2-chloropyridine-4-carbonyl)amino]phenyl]methyl]carbamate (PubChem CID 86673154) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is tert-butyl N-[[3-[(2-chloropyridine-4-carbonyl)amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[(2-chloropyridine-4-carbonyl)amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 86673154 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | tert-butyl N-[[3-[(2-chloropyridine-4-carbonyl)amino]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(NC(=O)c2ccnc(Cl)c2)c1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-18(2,3)25-17(24)21-11-12-5-4-6-14(9-12)22-16(23)13-7-8-20-15(19)10-13/h4-10H,11H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | VTDBDPDFAQUFGA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|